C23H26BrNO2 — CID 123650475
(6S)-3-[1-(4-bromo-2-methylphenyl)ethyl]-6-(2-methylprop-2-enyl)-6-phenyl-1,3-oxazinan-2-one (PubChem CID 123650475) has the molecular formula C23H26BrNO2 and a molecular weight of 428.37 g/mol. Its IUPAC name is (6S)-3-[1-(4-bromo-2-methylphenyl)ethyl]-6-(2-methylprop-2-enyl)-6-phenyl-1,3-oxazinan-2-one.
| Compound Name | (6S)-3-[1-(4-bromo-2-methylphenyl)ethyl]-6-(2-methylprop-2-enyl)-6-phenyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 123650475 |
| Molecular Formula | C23H26BrNO2 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | (6S)-3-[1-(4-bromo-2-methylphenyl)ethyl]-6-(2-methylprop-2-enyl)-6-phenyl-1,3-oxazinan-2-one |
| SMILES | C=C(C)C[C@@]1(c2ccccc2)CCN(C(C)c2ccc(Br)cc2C)C(=O)O1 |
| InChI | InChI=1S/C23H26BrNO2/c1-16(2)15-23(19-8-6-5-7-9-19)12-13-25(22(26)27-23)18(4)21-11-10-20(24)14-17(21)3/h5-11,14,18H,1,12-13,15H2,2-4H3/t18?,23-/m1/s1 |
| InChIKey | VCRBQZUJSXEBMO-WBPHRXDCSA-N |
| XLogP | 6.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|