C22H26BrNO — CID 140575471
(6S)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-(2-methylprop-2-enyl)-6-phenyl-1,3-oxazinane (PubChem CID 140575471) has the molecular formula C22H26BrNO and a molecular weight of 400.36 g/mol. Its IUPAC name is (6S)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-(2-methylprop-2-enyl)-6-phenyl-1,3-oxazinane.
| Compound Name | (6S)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-(2-methylprop-2-enyl)-6-phenyl-1,3-oxazinane |
|---|---|
| PubChem CID | 140575471 |
| Molecular Formula | C22H26BrNO |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | (6S)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-(2-methylprop-2-enyl)-6-phenyl-1,3-oxazinane |
| SMILES | C=C(C)C[C@@]1(c2ccccc2)CCN([C@@H](C)c2ccc(Br)cc2)CO1 |
| InChI | InChI=1S/C22H26BrNO/c1-17(2)15-22(20-7-5-4-6-8-20)13-14-24(16-25-22)18(3)19-9-11-21(23)12-10-19/h4-12,18H,1,13-16H2,2-3H3/t18-,22+/m0/s1 |
| InChIKey | NPWCEMUEXADNEM-PGRDOPGGSA-N |
| XLogP | 6.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|