C22H24BNO2 — CID 88570474
CID 88570474 (PubChem CID 88570474) has the molecular formula C22H24BNO2 and a molecular weight of 345.25 g/mol.
| Compound Name | CID 88570474 |
|---|---|
| PubChem CID | 88570474 |
| Molecular Formula | C22H24BNO2 |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | — |
| SMILES | [B]c1ccc([C@H](C)N2CC[C@](CC(=C)C)(c3ccccc3)OC2=O)cc1 |
| InChI | InChI=1S/C22H24BNO2/c1-16(2)15-22(19-7-5-4-6-8-19)13-14-24(21(25)26-22)17(3)18-9-11-20(23)12-10-18/h4-12,17H,1,13-15H2,2-3H3/t17-,22-/m0/s1 |
| InChIKey | QFGNKVZHCDOXLI-JTSKRJEESA-N |
| XLogP | 4.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|