C25H29N3O3 — CID 143929411
ethanimidoyl 4-[(1S)-1-[(6R)-6-(2-methylprop-2-enyl)-2-oxo-6-phenyl-1,3-oxazinan-3-yl]ethyl]benzenecarboximidate (PubChem CID 143929411) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is ethanimidoyl 4-[(1S)-1-[(6R)-6-(2-methylprop-2-enyl)-2-oxo-6-phenyl-1,3-oxazinan-3-yl]ethyl]benzenecarboximidate.
| Compound Name | ethanimidoyl 4-[(1S)-1-[(6R)-6-(2-methylprop-2-enyl)-2-oxo-6-phenyl-1,3-oxazinan-3-yl]ethyl]benzenecarboximidate |
|---|---|
| PubChem CID | 143929411 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | ethanimidoyl 4-[(1S)-1-[(6R)-6-(2-methylprop-2-enyl)-2-oxo-6-phenyl-1,3-oxazinan-3-yl]ethyl]benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])c1ccc([C@H](C)N2CC[C@](CC(=C)C)(c3ccccc3)OC2=O)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-17(2)16-25(22-8-6-5-7-9-22)14-15-28(24(29)31-25)18(3)20-10-12-21(13-11-20)23(27)30-19(4)26/h5-13,18,26-27H,1,14-16H2,2-4H3/b26-19+,27-23-/t18-,25-/m0/s1 |
| InChIKey | DKFOTGGIWBCPDF-UKAOCHFBSA-N |
| XLogP | 5.79 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|