C22H24BrNO3 — CID 174631407
3-[(1S)-1-(4-bromophenyl)ethyl]-6-(2-oxopropyl)-6-phenylmorpholine-2-carbaldehyde (PubChem CID 174631407) has the molecular formula C22H24BrNO3 and a molecular weight of 430.34 g/mol. Its IUPAC name is 3-[(1S)-1-(4-bromophenyl)ethyl]-6-(2-oxopropyl)-6-phenylmorpholine-2-carbaldehyde.
| Compound Name | 3-[(1S)-1-(4-bromophenyl)ethyl]-6-(2-oxopropyl)-6-phenylmorpholine-2-carbaldehyde |
|---|---|
| PubChem CID | 174631407 |
| Molecular Formula | C22H24BrNO3 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 3-[(1S)-1-(4-bromophenyl)ethyl]-6-(2-oxopropyl)-6-phenylmorpholine-2-carbaldehyde |
| SMILES | CC(=O)CC1(c2ccccc2)CNC([C@@H](C)c2ccc(Br)cc2)C(C=O)O1 |
| InChI | InChI=1S/C22H24BrNO3/c1-15(26)12-22(18-6-4-3-5-7-18)14-24-21(20(13-25)27-22)16(2)17-8-10-19(23)11-9-17/h3-11,13,16,20-21,24H,12,14H2,1-2H3/t16-,20?,21?,22?/m0/s1 |
| InChIKey | HBMMCBHNJRCPLY-XQDFYDKTSA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|