C22H25BrFNO2 — CID 143887004
3-[1-(4-bromophenyl)ethyl]-6-(2-methylprop-2-enyl)-1,3-oxazinan-2-one;fluorobenzene (PubChem CID 143887004) has the molecular formula C22H25BrFNO2 and a molecular weight of 434.35 g/mol. Its IUPAC name is 3-[1-(4-bromophenyl)ethyl]-6-(2-methylprop-2-enyl)-1,3-oxazinan-2-one;fluorobenzene.
| Compound Name | 3-[1-(4-bromophenyl)ethyl]-6-(2-methylprop-2-enyl)-1,3-oxazinan-2-one;fluorobenzene |
|---|---|
| PubChem CID | 143887004 |
| Molecular Formula | C22H25BrFNO2 |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 3-[1-(4-bromophenyl)ethyl]-6-(2-methylprop-2-enyl)-1,3-oxazinan-2-one;fluorobenzene |
| SMILES | C=C(C)CC1CCN(C(C)c2ccc(Br)cc2)C(=O)O1.Fc1ccccc1 |
| InChI | InChI=1S/C16H20BrNO2.C6H5F/c1-11(2)10-15-8-9-18(16(19)20-15)12(3)13-4-6-14(17)7-5-13;7-6-4-2-1-3-5-6/h4-7,12,15H,1,8-10H2,2-3H3;1-5H |
| InChIKey | BBKHXYBMUYEGLG-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|