C29H33N3O2 — CID 68547187
1-[(1S)-1-[4-(1-methyl-6-oxo-3-pyridinyl)phenyl]ethyl]-4-(2-methylprop-2-enyl)-4-phenyl-1,3-diazepan-2-one (PubChem CID 68547187) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is 1-[(1S)-1-[4-(1-methyl-6-oxo-3-pyridinyl)phenyl]ethyl]-4-(2-methylprop-2-enyl)-4-phenyl-1,3-diazepan-2-one.
| Compound Name | 1-[(1S)-1-[4-(1-methyl-6-oxo-3-pyridinyl)phenyl]ethyl]-4-(2-methylprop-2-enyl)-4-phenyl-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 68547187 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 1-[(1S)-1-[4-(1-methyl-6-oxo-3-pyridinyl)phenyl]ethyl]-4-(2-methylprop-2-enyl)-4-phenyl-1,3-diazepan-2-one |
| SMILES | C=C(C)CC1(c2ccccc2)CCCN([C@@H](C)c2ccc(-c3ccc(=O)n(C)c3)cc2)C(=O)N1 |
| InChI | InChI=1S/C29H33N3O2/c1-21(2)19-29(26-9-6-5-7-10-26)17-8-18-32(28(34)30-29)22(3)23-11-13-24(14-12-23)25-15-16-27(33)31(4)20-25/h5-7,9-16,20,22H,1,8,17-19H2,2-4H3,(H,30,34)/t22-,29?/m0/s1 |
| InChIKey | ZBHXPLOVLPNTNW-RBQQCVMASA-N |
| XLogP | 5.78 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|