C7H6ClNO3 — CID 14270490
4-chloro-3-methyl-4-nitrocyclohexa-2,5-dien-1-one (PubChem CID 14270490) has the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. Its IUPAC name is 4-chloro-3-methyl-4-nitrocyclohexa-2,5-dien-1-one.
| Compound Name | 4-chloro-3-methyl-4-nitrocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 14270490 |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.58 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | 4-chloro-3-methyl-4-nitrocyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(=O)C=CC1(Cl)[N+](=O)[O-] |
| InChI | InChI=1S/C7H6ClNO3/c1-5-4-6(10)2-3-7(5,8)9(11)12/h2-4H,1H3 |
| InChIKey | YZCSKUDBHFWPBL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.58 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|