C7H7Cl2NO2 — CID 150962594
2,5-dichloro-5-methyl-6-nitrocyclohexa-1,3-diene (PubChem CID 150962594) has the molecular formula C7H7Cl2NO2 and a molecular weight of 208.04 g/mol. Its IUPAC name is 2,5-dichloro-5-methyl-6-nitrocyclohexa-1,3-diene.
| Compound Name | 2,5-dichloro-5-methyl-6-nitrocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 150962594 |
| Molecular Formula | C7H7Cl2NO2 |
| Molecular Weight | 208.04 g/mol |
| Exact Mass | 206.99 |
| IUPAC Name | 2,5-dichloro-5-methyl-6-nitrocyclohexa-1,3-diene |
| SMILES | CC1(Cl)C=CC(Cl)=CC1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7Cl2NO2/c1-7(9)3-2-5(8)4-6(7)10(11)12/h2-4,6H,1H3 |
| InChIKey | LMKKQQBWNMUMOW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.04 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|