C8H11NO3 — CID 150679353
1,4-dimethyl-6-nitrocyclohexa-2,4-dien-1-ol (PubChem CID 150679353) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 1,4-dimethyl-6-nitrocyclohexa-2,4-dien-1-ol.
| Compound Name | 1,4-dimethyl-6-nitrocyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 150679353 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1,4-dimethyl-6-nitrocyclohexa-2,4-dien-1-ol |
| SMILES | CC1=CC([N+](=O)[O-])C(C)(O)C=C1 |
| InChI | InChI=1S/C8H11NO3/c1-6-3-4-8(2,10)7(5-6)9(11)12/h3-5,7,10H,1-2H3 |
| InChIKey | JHNUDUWNPSTBHW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|