C8H13N3O2 — CID 152749737
4-N,4-dimethyl-3-nitrocyclohexa-1,5-diene-1,4-diamine (PubChem CID 152749737) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4-N,4-dimethyl-3-nitrocyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 4-N,4-dimethyl-3-nitrocyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 152749737 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 4-N,4-dimethyl-3-nitrocyclohexa-1,5-diene-1,4-diamine |
| SMILES | CNC1(C)C=CC(N)=CC1[N+](=O)[O-] |
| InChI | InChI=1S/C8H13N3O2/c1-8(10-2)4-3-6(9)5-7(8)11(12)13/h3-5,7,10H,9H2,1-2H3 |
| InChIKey | DOYNCNRHVMEYAN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|