C7H9NO — CID 150471908
4-amino-6-methylcyclohexa-2,4-dien-1-one (PubChem CID 150471908) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is 4-amino-6-methylcyclohexa-2,4-dien-1-one.
| Compound Name | 4-amino-6-methylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 150471908 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 4-amino-6-methylcyclohexa-2,4-dien-1-one |
| SMILES | CC1C=C(N)C=CC1=O |
| InChI | InChI=1S/C7H9NO/c1-5-4-6(8)2-3-7(5)9/h2-5H,8H2,1H3 |
| InChIKey | HRYXODBXYBCFSD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |