C7H11N — CID 148963944
3-ethylcyclopenta-1,4-dien-1-amine (PubChem CID 148963944) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is 3-ethylcyclopenta-1,4-dien-1-amine.
| Compound Name | 3-ethylcyclopenta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 148963944 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 3-ethylcyclopenta-1,4-dien-1-amine |
| SMILES | CCC1C=CC(N)=C1 |
| InChI | InChI=1S/C7H11N/c1-2-6-3-4-7(8)5-6/h3-6H,2,8H2,1H3 |
| InChIKey | PSJDOHOCWMLUQJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |