C12H14N6O4 — CID 140997732
2-(1,4-diamino-6-nitrocyclohexa-2,4-dien-1-yl)-3-nitrobenzene-1,4-diamine (PubChem CID 140997732) has the molecular formula C12H14N6O4 and a molecular weight of 306.28 g/mol. Its IUPAC name is 2-(1,4-diamino-6-nitrocyclohexa-2,4-dien-1-yl)-3-nitrobenzene-1,4-diamine.
| Compound Name | 2-(1,4-diamino-6-nitrocyclohexa-2,4-dien-1-yl)-3-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 140997732 |
| Molecular Formula | C12H14N6O4 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-(1,4-diamino-6-nitrocyclohexa-2,4-dien-1-yl)-3-nitrobenzene-1,4-diamine |
| SMILES | NC1=CC([N+](=O)[O-])C(N)(c2c(N)ccc(N)c2[N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C12H14N6O4/c13-6-3-4-12(16,9(5-6)17(19)20)10-7(14)1-2-8(15)11(10)18(21)22/h1-5,9H,13-16H2 |
| InChIKey | PIFKPCPNIUQARH-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 190.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|