C6H7BrN2O2 — CID 140501915
4-bromo-4-nitrocyclohexa-1,5-dien-1-amine (PubChem CID 140501915) has the molecular formula C6H7BrN2O2 and a molecular weight of 219.04 g/mol. Its IUPAC name is 4-bromo-4-nitrocyclohexa-1,5-dien-1-amine.
| Compound Name | 4-bromo-4-nitrocyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 140501915 |
| Molecular Formula | C6H7BrN2O2 |
| Molecular Weight | 219.04 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | 4-bromo-4-nitrocyclohexa-1,5-dien-1-amine |
| SMILES | NC1=CCC(Br)([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C6H7BrN2O2/c7-6(9(10)11)3-1-5(8)2-4-6/h1-3H,4,8H2 |
| InChIKey | WNTOTPKSOGGDSN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.04 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|