C10H18N4O2 — CID 154003436
4-methyl-4-N-[2-(methylamino)ethyl]-5-nitrocyclohexa-1,5-diene-1,4-diamine (PubChem CID 154003436) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-methyl-4-N-[2-(methylamino)ethyl]-5-nitrocyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 4-methyl-4-N-[2-(methylamino)ethyl]-5-nitrocyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 154003436 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 4-methyl-4-N-[2-(methylamino)ethyl]-5-nitrocyclohexa-1,5-diene-1,4-diamine |
| SMILES | CNCCNC1(C)CC=C(N)C=C1[N+](=O)[O-] |
| InChI | InChI=1S/C10H18N4O2/c1-10(13-6-5-12-2)4-3-8(11)7-9(10)14(15)16/h3,7,12-13H,4-6,11H2,1-2H3 |
| InChIKey | URQJRFQOBFLIHO-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|