C9H13ClN4O6S — CID 14723805
N-[2-(methylamino)ethyl]-3,5-dinitrobenzenesulfonamide;hydrochloride (PubChem CID 14723805) has the molecular formula C9H13ClN4O6S and a molecular weight of 340.75 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-3,5-dinitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(methylamino)ethyl]-3,5-dinitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 14723805 |
| Molecular Formula | C9H13ClN4O6S |
| Molecular Weight | 340.75 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | N-[2-(methylamino)ethyl]-3,5-dinitrobenzenesulfonamide;hydrochloride |
| SMILES | CNCCNS(=O)(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C9H12N4O6S.ClH/c1-10-2-3-11-20(18,19)9-5-7(12(14)15)4-8(6-9)13(16)17;/h4-6,10-11H,2-3H2,1H3;1H |
| InChIKey | DGRZYBJTEIZTMW-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.75 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|