C6H6ClNO5S — CID 86741867
4-chloro-4-nitrocyclohexa-1,5-diene-1-sulfonic acid (PubChem CID 86741867) has the molecular formula C6H6ClNO5S and a molecular weight of 239.64 g/mol. Its IUPAC name is 4-chloro-4-nitrocyclohexa-1,5-diene-1-sulfonic acid.
| Compound Name | 4-chloro-4-nitrocyclohexa-1,5-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 86741867 |
| Molecular Formula | C6H6ClNO5S |
| Molecular Weight | 239.64 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | 4-chloro-4-nitrocyclohexa-1,5-diene-1-sulfonic acid |
| SMILES | O=[N+]([O-])C1(Cl)C=CC(S(=O)(=O)O)=CC1 |
| InChI | InChI=1S/C6H6ClNO5S/c7-6(8(9)10)3-1-5(2-4-6)14(11,12)13/h1-3H,4H2,(H,11,12,13) |
| InChIKey | YFZOHHXLERUNLS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.64 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|