C7H10O3S — CID 175808045
4-deuterio-4-methylcyclohexa-1,5-diene-1-sulfonic acid (PubChem CID 175808045) has the molecular formula C7H10O3S and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-deuterio-4-methylcyclohexa-1,5-diene-1-sulfonic acid.
| Compound Name | 4-deuterio-4-methylcyclohexa-1,5-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 175808045 |
| Molecular Formula | C7H10O3S |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 4-deuterio-4-methylcyclohexa-1,5-diene-1-sulfonic acid |
| SMILES | [2H]C1(C)C=CC(S(=O)(=O)O)=CC1 |
| InChI | InChI=1S/C7H10O3S/c1-6-2-4-7(5-3-6)11(8,9)10/h2,4-6H,3H2,1H3,(H,8,9,10)/i6D |
| InChIKey | XDMAYSFUAQSJDK-RAMDWTOOSA-N |
| XLogP | 1.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|