C9H16O3S — CID 158241854
3,4-dimethylcyclohexa-1,5-diene-1-sulfonic acid;methane (PubChem CID 158241854) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is 3,4-dimethylcyclohexa-1,5-diene-1-sulfonic acid;methane.
| Compound Name | 3,4-dimethylcyclohexa-1,5-diene-1-sulfonic acid;methane |
|---|---|
| PubChem CID | 158241854 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 3,4-dimethylcyclohexa-1,5-diene-1-sulfonic acid;methane |
| SMILES | C.CC1C=CC(S(=O)(=O)O)=CC1C |
| InChI | InChI=1S/C8H12O3S.CH4/c1-6-3-4-8(5-7(6)2)12(9,10)11;/h3-7H,1-2H3,(H,9,10,11);1H4 |
| InChIKey | GFQDSVSXQFPHSV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|