4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid

C8H11FO5S — CID 172794494

IUPAC4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid
SMILESCOC1C=C(S(=O)(=O)O)C=CC1(F)OC
InChIInChI=1S/C8H11FO5S/c1-13-7-5-6(15(10,11)12)3-4-8(7,9)14-2/h3-5,7H,1-2H3,(H,10,11,12)
InChIKeyQAAYGYUKKNIOPE-UHFFFAOYSA-N
MW238.24 g/mol
LogP0.66
Rot. Bonds3

About 4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid

4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid (PubChem CID 172794494) has the molecular formula C8H11FO5S and a molecular weight of 238.24 g/mol. Its IUPAC name is 4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid.

Molecular Properties

Compound Name4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid
PubChem CID172794494
Molecular FormulaC8H11FO5S
Molecular Weight238.24 g/mol
Exact Mass238.03
IUPAC Name4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid
SMILESCOC1C=C(S(=O)(=O)O)C=CC1(F)OC
InChIInChI=1S/C8H11FO5S/c1-13-7-5-6(15(10,11)12)3-4-8(7,9)14-2/h3-5,7H,1-2H3,(H,10,11,12)
InChIKeyQAAYGYUKKNIOPE-UHFFFAOYSA-N
XLogP0.66
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.24
LogP ≤ 50.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid?
The IUPAC name of 4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid (CID 172794494) is 4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid.
What is the SMILES notation for 4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid?
The canonical SMILES for 4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid is COC1C=C(S(=O)(=O)O)C=CC1(F)OC.
What is the InChIKey of 4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid?
The InChIKey is QAAYGYUKKNIOPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FO5S/c1-13-7-5-6(15(10,11)12)3-4-8(7,9)14-2/h3-5,7H,1-2H3,(H,10,11,12).
What are the key properties of 4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid?
4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid has a molecular weight of 238.24 g/mol, XLogP of 0.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid is sourced from PubChem (CID 172794494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).