C8H11FO5S — CID 172794494
4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid (PubChem CID 172794494) has the molecular formula C8H11FO5S and a molecular weight of 238.24 g/mol. Its IUPAC name is 4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid.
| Compound Name | 4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 172794494 |
| Molecular Formula | C8H11FO5S |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 4-fluoro-3,4-dimethoxycyclohexa-1,5-diene-1-sulfonic acid |
| SMILES | COC1C=C(S(=O)(=O)O)C=CC1(F)OC |
| InChI | InChI=1S/C8H11FO5S/c1-13-7-5-6(15(10,11)12)3-4-8(7,9)14-2/h3-5,7H,1-2H3,(H,10,11,12) |
| InChIKey | QAAYGYUKKNIOPE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|