C12H16O4 — CID 151417601
3-(3,4-dimethoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid (PubChem CID 151417601) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-(3,4-dimethoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid.
| Compound Name | 3-(3,4-dimethoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 151417601 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 3-(3,4-dimethoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid |
| SMILES | COC1C=C(C=CC(=O)O)C=CC1(C)OC |
| InChI | InChI=1S/C12H16O4/c1-12(16-3)7-6-9(4-5-11(13)14)8-10(12)15-2/h4-8,10H,1-3H3,(H,13,14) |
| InChIKey | OZVSBXQKDGULRU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|