C18H19NO3 — CID 69411628
3-(4-amino-3-benzylidene-4-methoxy-2-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid (PubChem CID 69411628) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-(4-amino-3-benzylidene-4-methoxy-2-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid.
| Compound Name | 3-(4-amino-3-benzylidene-4-methoxy-2-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 69411628 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-(4-amino-3-benzylidene-4-methoxy-2-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid |
| SMILES | COC1(N)C=CC(C=CC(=O)O)=C(C)C1=Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-13-15(8-9-17(20)21)10-11-18(19,22-2)16(13)12-14-6-4-3-5-7-14/h3-12H,19H2,1-2H3,(H,20,21) |
| InChIKey | GAGOTUDWXCXEMW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|