C9H10O6 — CID 142701690
(E)-3-(3,3,4,4-tetrahydroxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid (PubChem CID 142701690) has the molecular formula C9H10O6 and a molecular weight of 214.17 g/mol. Its IUPAC name is (E)-3-(3,3,4,4-tetrahydroxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(3,3,4,4-tetrahydroxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 142701690 |
| Molecular Formula | C9H10O6 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (E)-3-(3,3,4,4-tetrahydroxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/C1=CC(O)(O)C(O)(O)C=C1 |
| InChI | InChI=1S/C9H10O6/c10-7(11)2-1-6-3-4-8(12,13)9(14,15)5-6/h1-5,12-15H,(H,10,11)/b2-1+ |
| InChIKey | NVXKFMJLCGOOFT-OWOJBTEDSA-N |
| XLogP | -1.51 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|