C11H14O3 — CID 142791124
3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid (PubChem CID 142791124) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid.
| Compound Name | 3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 142791124 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid |
| SMILES | COC1(C)C=CC(C=CC(=O)O)=CC1 |
| InChI | InChI=1S/C11H14O3/c1-11(14-2)7-5-9(6-8-11)3-4-10(12)13/h3-7H,8H2,1-2H3,(H,12,13) |
| InChIKey | FXPXZGVBXYEYLV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|