3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid

C11H14O3 — CID 142791124

IUPAC3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid
SMILESCOC1(C)C=CC(C=CC(=O)O)=CC1
InChIInChI=1S/C11H14O3/c1-11(14-2)7-5-9(6-8-11)3-4-10(12)13/h3-7H,8H2,1-2H3,(H,12,13)
InChIKeyFXPXZGVBXYEYLV-UHFFFAOYSA-N
MW194.23 g/mol
LogP1.92
Rot. Bonds3

About 3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid

3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid (PubChem CID 142791124) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid.

Molecular Properties

Compound Name3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid
PubChem CID142791124
Molecular FormulaC11H14O3
Molecular Weight194.23 g/mol
Exact Mass194.09
IUPAC Name3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid
SMILESCOC1(C)C=CC(C=CC(=O)O)=CC1
InChIInChI=1S/C11H14O3/c1-11(14-2)7-5-9(6-8-11)3-4-10(12)13/h3-7H,8H2,1-2H3,(H,12,13)
InChIKeyFXPXZGVBXYEYLV-UHFFFAOYSA-N
XLogP1.92
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.23
LogP ≤ 51.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid?
The IUPAC name of 3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid (CID 142791124) is 3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid.
What is the SMILES notation for 3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid?
The canonical SMILES for 3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid is COC1(C)C=CC(C=CC(=O)O)=CC1.
What is the InChIKey of 3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid?
The InChIKey is FXPXZGVBXYEYLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-11(14-2)7-5-9(6-8-11)3-4-10(12)13/h3-7H,8H2,1-2H3,(H,12,13).
What are the key properties of 3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid?
3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid has a molecular weight of 194.23 g/mol, XLogP of 1.92, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)prop-2-enoic acid is sourced from PubChem (CID 142791124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).