C6H8O11S3 — CID 19825486
1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid (PubChem CID 19825486) has the molecular formula C6H8O11S3 and a molecular weight of 352.32 g/mol. Its IUPAC name is 1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid.
| Compound Name | 1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid |
|---|---|
| PubChem CID | 19825486 |
| Molecular Formula | C6H8O11S3 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.92 |
| IUPAC Name | 1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid |
| SMILES | O=S(=O)(O)C1=CC(O)(S(=O)(=O)O)C(O)(S(=O)(=O)O)C=C1 |
| InChI | InChI=1S/C6H8O11S3/c7-5(19(12,13)14)2-1-4(18(9,10)11)3-6(5,8)20(15,16)17/h1-3,7-8H,(H,9,10,11)(H,12,13,14)(H,15,16,17) |
| InChIKey | YIBLQDIFJPWHLU-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 203.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|