1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid

C6H8O11S3 — CID 19825486

IUPAC1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid
SMILESO=S(=O)(O)C1=CC(O)(S(=O)(=O)O)C(O)(S(=O)(=O)O)C=C1
InChIInChI=1S/C6H8O11S3/c7-5(19(12,13)14)2-1-4(18(9,10)11)3-6(5,8)20(15,16)17/h1-3,7-8H,(H,9,10,11)(H,12,13,14)(H,15,16,17)
InChIKeyYIBLQDIFJPWHLU-UHFFFAOYSA-N
MW352.32 g/mol
LogP-2.52
Rot. Bonds3

About 1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid

1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid (PubChem CID 19825486) has the molecular formula C6H8O11S3 and a molecular weight of 352.32 g/mol. Its IUPAC name is 1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid.

Molecular Properties

Compound Name1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid
PubChem CID19825486
Molecular FormulaC6H8O11S3
Molecular Weight352.32 g/mol
Exact Mass351.92
IUPAC Name1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid
SMILESO=S(=O)(O)C1=CC(O)(S(=O)(=O)O)C(O)(S(=O)(=O)O)C=C1
InChIInChI=1S/C6H8O11S3/c7-5(19(12,13)14)2-1-4(18(9,10)11)3-6(5,8)20(15,16)17/h1-3,7-8H,(H,9,10,11)(H,12,13,14)(H,15,16,17)
InChIKeyYIBLQDIFJPWHLU-UHFFFAOYSA-N
XLogP-2.52
TPSA203.57 Ų
H-Bond Donors5
H-Bond Acceptors8
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.32
LogP ≤ 5-2.52
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid?
The IUPAC name of 1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid (CID 19825486) is 1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid.
What is the SMILES notation for 1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid?
The canonical SMILES for 1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid is O=S(=O)(O)C1=CC(O)(S(=O)(=O)O)C(O)(S(=O)(=O)O)C=C1.
What is the InChIKey of 1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid?
The InChIKey is YIBLQDIFJPWHLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O11S3/c7-5(19(12,13)14)2-1-4(18(9,10)11)3-6(5,8)20(15,16)17/h1-3,7-8H,(H,9,10,11)(H,12,13,14)(H,15,16,17).
What are the key properties of 1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid?
1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid has a molecular weight of 352.32 g/mol, XLogP of -2.52, 3 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroxycyclohexa-3,5-diene-1,2,4-trisulfonic acid is sourced from PubChem (CID 19825486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).