C12H18N4O6S — CID 140555943
6,6-diamino-4-(3,3-diamino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-2,4-diene-1,1-diol (PubChem CID 140555943) has the molecular formula C12H18N4O6S and a molecular weight of 346.37 g/mol. Its IUPAC name is 6,6-diamino-4-(3,3-diamino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-2,4-diene-1,1-diol.
| Compound Name | 6,6-diamino-4-(3,3-diamino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 140555943 |
| Molecular Formula | C12H18N4O6S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 6,6-diamino-4-(3,3-diamino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-2,4-diene-1,1-diol |
| SMILES | NC1(N)C=C(S(=O)(=O)C2=CC(N)(N)C(O)(O)C=C2)C=CC1(O)O |
| InChI | InChI=1S/C12H18N4O6S/c13-9(14)5-7(1-3-11(9,17)18)23(21,22)8-2-4-12(19,20)10(15,16)6-8/h1-6,17-20H,13-16H2 |
| InChIKey | DLLZJVSBDOYVBC-UHFFFAOYSA-N |
| XLogP | -4.10 |
| TPSA | 219.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|