C24H20O4S — CID 54465950
4-(benzenesulfonyl)-6,6-diphenylcyclohexa-2,4-diene-1,1-diol (PubChem CID 54465950) has the molecular formula C24H20O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-6,6-diphenylcyclohexa-2,4-diene-1,1-diol.
| Compound Name | 4-(benzenesulfonyl)-6,6-diphenylcyclohexa-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 54465950 |
| Molecular Formula | C24H20O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 4-(benzenesulfonyl)-6,6-diphenylcyclohexa-2,4-diene-1,1-diol |
| SMILES | O=S(=O)(C1=CC(c2ccccc2)(c2ccccc2)C(O)(O)C=C1)c1ccccc1 |
| InChI | InChI=1S/C24H20O4S/c25-24(26)17-16-22(29(27,28)21-14-8-3-9-15-21)18-23(24,19-10-4-1-5-11-19)20-12-6-2-7-13-20/h1-18,25-26H |
| InChIKey | XEVZSXLWZPJTBI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|