C12H19NO2S — CID 123992831
3,3,6,6-tetramethylcycloocta-1,4,7-triene-1-sulfonamide (PubChem CID 123992831) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 3,3,6,6-tetramethylcycloocta-1,4,7-triene-1-sulfonamide.
| Compound Name | 3,3,6,6-tetramethylcycloocta-1,4,7-triene-1-sulfonamide |
|---|---|
| PubChem CID | 123992831 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 3,3,6,6-tetramethylcycloocta-1,4,7-triene-1-sulfonamide |
| SMILES | CC1(C)C=CC(S(N)(=O)=O)=CC(C)(C)C=C1 |
| InChI | InChI=1S/C12H19NO2S/c1-11(2)6-5-10(16(13,14)15)9-12(3,4)8-7-11/h5-9H,1-4H3,(H2,13,14,15) |
| InChIKey | UGXSBZAGJTUCRB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|