C7H9Br — CID 10844938
2-bromo-5,5-dimethylcyclopenta-1,3-diene (PubChem CID 10844938) has the molecular formula C7H9Br and a molecular weight of 173.05 g/mol. Its IUPAC name is 2-bromo-5,5-dimethylcyclopenta-1,3-diene.
| Compound Name | 2-bromo-5,5-dimethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 10844938 |
| Molecular Formula | C7H9Br |
| Molecular Weight | 173.05 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | 2-bromo-5,5-dimethylcyclopenta-1,3-diene |
| SMILES | CC1(C)C=CC(Br)=C1 |
| InChI | InChI=1S/C7H9Br/c1-7(2)4-3-6(8)5-7/h3-5H,1-2H3 |
| InChIKey | NWYLVVVVPMXHQL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.05 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |