C15H26Si — CID 5366639
trimethyl-[(1E,4Z,7Z)-3,3,6,6-tetramethylcycloocta-1,4,7-trien-1-yl]silane (PubChem CID 5366639) has the molecular formula C15H26Si and a molecular weight of 234.46 g/mol. Its IUPAC name is trimethyl-[(1E,4Z,7Z)-3,3,6,6-tetramethylcycloocta-1,4,7-trien-1-yl]silane.
| Compound Name | trimethyl-[(1E,4Z,7Z)-3,3,6,6-tetramethylcycloocta-1,4,7-trien-1-yl]silane |
|---|---|
| PubChem CID | 5366639 |
| Molecular Formula | C15H26Si |
| Molecular Weight | 234.46 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | trimethyl-[(1E,4Z,7Z)-3,3,6,6-tetramethylcycloocta-1,4,7-trien-1-yl]silane |
| SMILES | CC1(C)/C=C\C([Si](C)(C)C)=C/C(C)(C)/C=C\1 |
| InChI | InChI=1S/C15H26Si/c1-14(2)9-8-13(16(5,6)7)12-15(3,4)11-10-14/h8-12H,1-7H3/b9-8-,11-10-,13-12+ |
| InChIKey | JHZJPAVPOXJFQG-ODCQOWALSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|