C17H19N — CID 154019168
2,2,6,6-tetramethylacridine (PubChem CID 154019168) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is 2,2,6,6-tetramethylacridine.
| Compound Name | 2,2,6,6-tetramethylacridine |
|---|---|
| PubChem CID | 154019168 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2,2,6,6-tetramethylacridine |
| SMILES | CC1(C)C=Cc2nc3c(cc2=C1)C=CC(C)(C)C=3 |
| InChI | InChI=1S/C17H19N/c1-16(2)8-6-14-13(10-16)9-12-5-7-17(3,4)11-15(12)18-14/h5-11H,1-4H3 |
| InChIKey | WXIQZUFSVAGKEY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |