C8H11Br — CID 101127342
2-bromo-5,5-dimethylcyclohexa-1,3-diene (PubChem CID 101127342) has the molecular formula C8H11Br and a molecular weight of 187.08 g/mol. Its IUPAC name is 2-bromo-5,5-dimethylcyclohexa-1,3-diene.
| Compound Name | 2-bromo-5,5-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 101127342 |
| Molecular Formula | C8H11Br |
| Molecular Weight | 187.08 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | 2-bromo-5,5-dimethylcyclohexa-1,3-diene |
| SMILES | CC1(C)C=CC(Br)=CC1 |
| InChI | InChI=1S/C8H11Br/c1-8(2)5-3-7(9)4-6-8/h3-5H,6H2,1-2H3 |
| InChIKey | FZFQETYOSWCFLW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.08 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |