4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid

C8H12O2S — CID 147294365

IUPAC4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid
SMILESCC1(C)C=CC(S(=O)O)=CC1
InChIInChI=1S/C8H12O2S/c1-8(2)5-3-7(4-6-8)11(9)10/h3-5H,6H2,1-2H3,(H,9,10)
InChIKeyRXKZRLRLPUYVLY-UHFFFAOYSA-N
MW172.25 g/mol
LogP2.08
Rot. Bonds1

About 4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid

4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid (PubChem CID 147294365) has the molecular formula C8H12O2S and a molecular weight of 172.25 g/mol. Its IUPAC name is 4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid.

Molecular Properties

Compound Name4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid
PubChem CID147294365
Molecular FormulaC8H12O2S
Molecular Weight172.25 g/mol
Exact Mass172.06
IUPAC Name4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid
SMILESCC1(C)C=CC(S(=O)O)=CC1
InChIInChI=1S/C8H12O2S/c1-8(2)5-3-7(4-6-8)11(9)10/h3-5H,6H2,1-2H3,(H,9,10)
InChIKeyRXKZRLRLPUYVLY-UHFFFAOYSA-N
XLogP2.08
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.25
LogP ≤ 52.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid?
The IUPAC name of 4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid (CID 147294365) is 4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid.
What is the SMILES notation for 4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid?
The canonical SMILES for 4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid is CC1(C)C=CC(S(=O)O)=CC1.
What is the InChIKey of 4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid?
The InChIKey is RXKZRLRLPUYVLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2S/c1-8(2)5-3-7(4-6-8)11(9)10/h3-5H,6H2,1-2H3,(H,9,10).
What are the key properties of 4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid?
4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid has a molecular weight of 172.25 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid is sourced from PubChem (CID 147294365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).