C15H23NO — CID 102526052
(3E,7E,11E)-5,5,8,12-tetramethyl-1-azacyclododeca-3,7,11-trien-2-one (PubChem CID 102526052) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (3E,7E,11E)-5,5,8,12-tetramethyl-1-azacyclododeca-3,7,11-trien-2-one.
| Compound Name | (3E,7E,11E)-5,5,8,12-tetramethyl-1-azacyclododeca-3,7,11-trien-2-one |
|---|---|
| PubChem CID | 102526052 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (3E,7E,11E)-5,5,8,12-tetramethyl-1-azacyclododeca-3,7,11-trien-2-one |
| SMILES | C/C1=C\CC(C)(C)/C=C/C(=O)N/C(C)=C/CC1 |
| InChI | InChI=1S/C15H23NO/c1-12-6-5-7-13(2)16-14(17)9-11-15(3,4)10-8-12/h7-9,11H,5-6,10H2,1-4H3,(H,16,17)/b11-9+,12-8+,13-7+ |
| InChIKey | YMIPTTDIJCZDAB-SKTNYSRSSA-N |
| XLogP | 3.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|