C15H24S — CID 162946968
3,3,6,10-tetramethylcycloundeca-1,5,9-triene-1-thiol (PubChem CID 162946968) has the molecular formula C15H24S and a molecular weight of 236.42 g/mol. Its IUPAC name is 3,3,6,10-tetramethylcycloundeca-1,5,9-triene-1-thiol.
| Compound Name | 3,3,6,10-tetramethylcycloundeca-1,5,9-triene-1-thiol |
|---|---|
| PubChem CID | 162946968 |
| Molecular Formula | C15H24S |
| Molecular Weight | 236.42 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3,3,6,10-tetramethylcycloundeca-1,5,9-triene-1-thiol |
| SMILES | CC1=CCC(C)(C)C=C(S)CC(C)=CCC1 |
| InChI | InChI=1S/C15H24S/c1-12-6-5-7-13(2)10-14(16)11-15(3,4)9-8-12/h7-8,11,16H,5-6,9-10H2,1-4H3 |
| InChIKey | RJISBTRGFYEHQC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|