5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid

C15H22O2 — CID 74202895

IUPAC5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid
SMILESCC1=CCC(C)(C)C=CCC(C(=O)O)=CCC1
InChIInChI=1S/C15H22O2/c1-12-6-4-7-13(14(16)17)8-5-10-15(2,3)11-9-12/h5,7,9-10H,4,6,8,11H2,1-3H3,(H,16,17)
InChIKeySKLVDHKDDUKBHT-UHFFFAOYSA-N
MW234.34 g/mol
LogP4.10
Rot. Bonds1

About 5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid

5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid (PubChem CID 74202895) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid.

Molecular Properties

Compound Name5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid
PubChem CID74202895
Molecular FormulaC15H22O2
Molecular Weight234.34 g/mol
Exact Mass234.16
IUPAC Name5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid
SMILESCC1=CCC(C)(C)C=CCC(C(=O)O)=CCC1
InChIInChI=1S/C15H22O2/c1-12-6-4-7-13(14(16)17)8-5-10-15(2,3)11-9-12/h5,7,9-10H,4,6,8,11H2,1-3H3,(H,16,17)
InChIKeySKLVDHKDDUKBHT-UHFFFAOYSA-N
XLogP4.10
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.34
LogP ≤ 54.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid?
The IUPAC name of 5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid (CID 74202895) is 5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid.
What is the SMILES notation for 5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid?
The canonical SMILES for 5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid is CC1=CCC(C)(C)C=CCC(C(=O)O)=CCC1.
What is the InChIKey of 5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid?
The InChIKey is SKLVDHKDDUKBHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2/c1-12-6-4-7-13(14(16)17)8-5-10-15(2,3)11-9-12/h5,7,9-10H,4,6,8,11H2,1-3H3,(H,16,17).
What are the key properties of 5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid?
5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid has a molecular weight of 234.34 g/mol, XLogP of 4.10, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8,8-trimethylcycloundeca-1,5,9-triene-1-carboxylic acid is sourced from PubChem (CID 74202895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).