C15H26O2 — CID 177497934
(1R,2S,4Z,8E)-2,6,6,9-tetramethylcycloundeca-4,8-diene-1,2-diol (PubChem CID 177497934) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (1R,2S,4Z,8E)-2,6,6,9-tetramethylcycloundeca-4,8-diene-1,2-diol.
| Compound Name | (1R,2S,4Z,8E)-2,6,6,9-tetramethylcycloundeca-4,8-diene-1,2-diol |
|---|---|
| PubChem CID | 177497934 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (1R,2S,4Z,8E)-2,6,6,9-tetramethylcycloundeca-4,8-diene-1,2-diol |
| SMILES | C/C1=C\CC(C)(C)/C=C\C[C@](C)(O)[C@H](O)CC1 |
| InChI | InChI=1S/C15H26O2/c1-12-6-7-13(16)15(4,17)10-5-9-14(2,3)11-8-12/h5,8-9,13,16-17H,6-7,10-11H2,1-4H3/b9-5-,12-8+/t13-,15+/m1/s1 |
| InChIKey | UVZIXGPVWYZAAF-BRLWBIKESA-N |
| XLogP | 3.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|