C15H22Br2O — CID 10499849
(2E,6E)-10,11-dibromo-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one (PubChem CID 10499849) has the molecular formula C15H22Br2O and a molecular weight of 378.15 g/mol. Its IUPAC name is (2E,6E)-10,11-dibromo-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one.
| Compound Name | (2E,6E)-10,11-dibromo-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one |
|---|---|
| PubChem CID | 10499849 |
| Molecular Formula | C15H22Br2O |
| Molecular Weight | 378.15 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | (2E,6E)-10,11-dibromo-4,4,7,11-tetramethylcycloundeca-2,6-dien-1-one |
| SMILES | C/C1=C\CC(C)(C)/C=C/C(=O)C(C)(Br)C(Br)CC1 |
| InChI | InChI=1S/C15H22Br2O/c1-11-5-6-12(16)15(4,17)13(18)8-10-14(2,3)9-7-11/h7-8,10,12H,5-6,9H2,1-4H3/b10-8+,11-7+ |
| InChIKey | RPVBCYODWHINTB-VTTRTIMMSA-N |
| XLogP | 5.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.15 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|