C20H32O5 — CID 72945528
(3aR,6R,7E,10S,11R,14E,15aS)-6,10,14-trimethyl-3-methylidene-5,9,11,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-3a,6,10,11-tetrol (PubChem CID 72945528) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (3aR,6R,7E,10S,11R,14E,15aS)-6,10,14-trimethyl-3-methylidene-5,9,11,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-3a,6,10,11-tetrol.
| Compound Name | (3aR,6R,7E,10S,11R,14E,15aS)-6,10,14-trimethyl-3-methylidene-5,9,11,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-3a,6,10,11-tetrol |
|---|---|
| PubChem CID | 72945528 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (3aR,6R,7E,10S,11R,14E,15aS)-6,10,14-trimethyl-3-methylidene-5,9,11,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-3a,6,10,11-tetrol |
| SMILES | C=C1CO[C@H]2/C=C(\C)CC[C@@H](O)[C@@](C)(O)C/C=C/[C@](C)(O)CC[C@@]12O |
| InChI | InChI=1S/C20H32O5/c1-14-6-7-16(21)19(4,23)9-5-8-18(3,22)10-11-20(24)15(2)13-25-17(20)12-14/h5,8,12,16-17,21-24H,2,6-7,9-11,13H2,1,3-4H3/b8-5+,14-12+/t16-,17+,18+,19+,20-/m1/s1 |
| InChIKey | QWQCCBLIKLMUJQ-AIZJHLRRSA-N |
| XLogP | 2.00 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|