C12H18O2 — CID 101339280
(2R,6Z)-5-methyl-2-[(1R)-2-methylidenecyclopropyl]-2,3,4,8-tetrahydrooxocin-5-ol (PubChem CID 101339280) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (2R,6Z)-5-methyl-2-[(1R)-2-methylidenecyclopropyl]-2,3,4,8-tetrahydrooxocin-5-ol.
| Compound Name | (2R,6Z)-5-methyl-2-[(1R)-2-methylidenecyclopropyl]-2,3,4,8-tetrahydrooxocin-5-ol |
|---|---|
| PubChem CID | 101339280 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (2R,6Z)-5-methyl-2-[(1R)-2-methylidenecyclopropyl]-2,3,4,8-tetrahydrooxocin-5-ol |
| SMILES | C=C1C[C@H]1[C@H]1CCC(C)(O)/C=C\CO1 |
| InChI | InChI=1S/C12H18O2/c1-9-8-10(9)11-4-6-12(2,13)5-3-7-14-11/h3,5,10-11,13H,1,4,6-8H2,2H3/b5-3-/t10-,11-,12?/m1/s1 |
| InChIKey | PFODIUSASZQMIT-ZTJZLLGJSA-N |
| XLogP | 2.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|