C16H26 — CID 140996280
(1Z,4Z,8Z)-5,9,12,12-tetramethylcyclododeca-1,4,8-triene (PubChem CID 140996280) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is (1Z,4Z,8Z)-5,9,12,12-tetramethylcyclododeca-1,4,8-triene.
| Compound Name | (1Z,4Z,8Z)-5,9,12,12-tetramethylcyclododeca-1,4,8-triene |
|---|---|
| PubChem CID | 140996280 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | (1Z,4Z,8Z)-5,9,12,12-tetramethylcyclododeca-1,4,8-triene |
| SMILES | C/C1=C/C/C=C\C(C)(C)CC/C(C)=C\CC1 |
| InChI | InChI=1S/C16H26/c1-14-8-5-6-12-16(3,4)13-11-15(2)10-7-9-14/h6,8,10,12H,5,7,9,11,13H2,1-4H3/b12-6-,14-8-,15-10- |
| InChIKey | YYWQPTKWRMGXPI-SNFGVDASSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|