C17H28 — CID 175103476
(1Z,4Z,7Z)-1,5,9,9-tetramethylcyclotrideca-1,4,7-triene (PubChem CID 175103476) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is (1Z,4Z,7Z)-1,5,9,9-tetramethylcyclotrideca-1,4,7-triene.
| Compound Name | (1Z,4Z,7Z)-1,5,9,9-tetramethylcyclotrideca-1,4,7-triene |
|---|---|
| PubChem CID | 175103476 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | (1Z,4Z,7Z)-1,5,9,9-tetramethylcyclotrideca-1,4,7-triene |
| SMILES | C/C1=C/C/C=C(/C)CCCCC(C)(C)/C=C\C1 |
| InChI | InChI=1S/C17H28/c1-15-9-5-6-13-17(3,4)14-8-12-16(2)11-7-10-15/h8,10-11,14H,5-7,9,12-13H2,1-4H3/b14-8-,15-10-,16-11- |
| InChIKey | LEGVIPZGPUJLCP-PNZBZYLHSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|