C9H12O — CID 143207326
(1E,4Z)-5-methylcycloocta-1,4,7-trien-1-ol (PubChem CID 143207326) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is (1E,4Z)-5-methylcycloocta-1,4,7-trien-1-ol.
| Compound Name | (1E,4Z)-5-methylcycloocta-1,4,7-trien-1-ol |
|---|---|
| PubChem CID | 143207326 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | (1E,4Z)-5-methylcycloocta-1,4,7-trien-1-ol |
| SMILES | C/C1=C/C/C=C(/O)C=CC1 |
| InChI | InChI=1S/C9H12O/c1-8-4-2-6-9(10)7-3-5-8/h2,5-7,10H,3-4H2,1H3/b6-2?,8-5-,9-7+ |
| InChIKey | BXQQQYACCXEDPF-QVZIHVPKSA-N |
| XLogP | 2.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|