(4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride

C6H8ClNO — CID 53429663

IUPAC(4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride
SMILES[Cl-].[NH2+]=C1C=CC(O)=CC1
InChIInChI=1S/C6H7NO.ClH/c7-5-1-3-6(8)4-2-5;/h1,3-4,7-8H,2H2;1H
InChIKeyDYJHJGYPPFXQES-UHFFFAOYSA-N
MW145.59 g/mol
LogP-3.41
Rot. Bonds

About (4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride

(4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride (PubChem CID 53429663) has the molecular formula C6H8ClNO and a molecular weight of 145.59 g/mol. Its IUPAC name is (4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride.

Molecular Properties

Compound Name(4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride
PubChem CID53429663
Molecular FormulaC6H8ClNO
Molecular Weight145.59 g/mol
Exact Mass145.03
IUPAC Name(4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride
SMILES[Cl-].[NH2+]=C1C=CC(O)=CC1
InChIInChI=1S/C6H7NO.ClH/c7-5-1-3-6(8)4-2-5;/h1,3-4,7-8H,2H2;1H
InChIKeyDYJHJGYPPFXQES-UHFFFAOYSA-N
XLogP-3.41
TPSA45.82 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.59
LogP ≤ 5-3.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze (4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride?
The IUPAC name of (4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride (CID 53429663) is (4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride.
What is the SMILES notation for (4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride?
The canonical SMILES for (4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride is [Cl-].[NH2+]=C1C=CC(O)=CC1.
What is the InChIKey of (4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride?
The InChIKey is DYJHJGYPPFXQES-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO.ClH/c7-5-1-3-6(8)4-2-5;/h1,3-4,7-8H,2H2;1H.
What are the key properties of (4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride?
(4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride has a molecular weight of 145.59 g/mol, XLogP of -3.41, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride is sourced from PubChem (CID 53429663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).