C6H8ClNO — CID 53429663
(4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride (PubChem CID 53429663) has the molecular formula C6H8ClNO and a molecular weight of 145.59 g/mol. Its IUPAC name is (4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride.
| Compound Name | (4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride |
|---|---|
| PubChem CID | 53429663 |
| Molecular Formula | C6H8ClNO |
| Molecular Weight | 145.59 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | (4-hydroxycyclohexa-2,4-dien-1-ylidene)azanium chloride |
| SMILES | [Cl-].[NH2+]=C1C=CC(O)=CC1 |
| InChI | InChI=1S/C6H7NO.ClH/c7-5-1-3-6(8)4-2-5;/h1,3-4,7-8H,2H2;1H |
| InChIKey | DYJHJGYPPFXQES-UHFFFAOYSA-N |
| XLogP | -3.41 |
| TPSA | 45.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.59 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|