C10H12O — CID 142555250
5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-ol (PubChem CID 142555250) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is 5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-ol.
| Compound Name | 5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-ol |
|---|---|
| PubChem CID | 142555250 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 5-[(E)-prop-1-enyl]cyclohepta-1,4,6-trien-1-ol |
| SMILES | C/C=C/C1=CCC=C(O)C=C1 |
| InChI | InChI=1S/C10H12O/c1-2-4-9-5-3-6-10(11)8-7-9/h2,4-8,11H,3H2,1H3/b4-2+ |
| InChIKey | VNBSYQNHWBYYMF-DUXPYHPUSA-N |
| XLogP | 2.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |