C10H14O — CID 145053129
(1E,6Z)-5-ethylcycloocta-1,4,6-trien-1-ol (PubChem CID 145053129) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (1E,6Z)-5-ethylcycloocta-1,4,6-trien-1-ol.
| Compound Name | (1E,6Z)-5-ethylcycloocta-1,4,6-trien-1-ol |
|---|---|
| PubChem CID | 145053129 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (1E,6Z)-5-ethylcycloocta-1,4,6-trien-1-ol |
| SMILES | CCC1=CC/C=C(/O)C/C=C\1 |
| InChI | InChI=1S/C10H14O/c1-2-9-5-3-7-10(11)8-4-6-9/h3,5-6,8,11H,2,4,7H2,1H3/b5-3-,9-6?,10-8+ |
| InChIKey | JSQPLDGGVBXPDU-BGWBVZTMSA-N |
| XLogP | 3.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |