C18H24N4O — CID 155739964
2-[(1Z)-1,4,4-triamino-3-(4-ethyl-2,7-dihydroazepin-1-yl)buta-1,3-dienyl]phenol (PubChem CID 155739964) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-[(1Z)-1,4,4-triamino-3-(4-ethyl-2,7-dihydroazepin-1-yl)buta-1,3-dienyl]phenol.
| Compound Name | 2-[(1Z)-1,4,4-triamino-3-(4-ethyl-2,7-dihydroazepin-1-yl)buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 155739964 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-[(1Z)-1,4,4-triamino-3-(4-ethyl-2,7-dihydroazepin-1-yl)buta-1,3-dienyl]phenol |
| SMILES | CCC1=CCN(C(/C=C(\N)c2ccccc2O)=C(N)N)CC=C1 |
| InChI | InChI=1S/C18H24N4O/c1-2-13-6-5-10-22(11-9-13)16(18(20)21)12-15(19)14-7-3-4-8-17(14)23/h3-9,12,23H,2,10-11,19-21H2,1H3/b15-12- |
| InChIKey | FAJMEBXRXLFDOU-QINSGFPZSA-N |
| XLogP | 1.99 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|