C24H44N6O2 — CID 168903277
ethane;2-ethoxy-N-methylethanamine;2-[(1Z)-1,4,4-triamino-3-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)buta-1,3-dienyl]phenol (PubChem CID 168903277) has the molecular formula C24H44N6O2 and a molecular weight of 448.66 g/mol. Its IUPAC name is ethane;2-ethoxy-N-methylethanamine;2-[(1Z)-1,4,4-triamino-3-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)buta-1,3-dienyl]phenol.
| Compound Name | ethane;2-ethoxy-N-methylethanamine;2-[(1Z)-1,4,4-triamino-3-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 168903277 |
| Molecular Formula | C24H44N6O2 |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.35 |
| IUPAC Name | ethane;2-ethoxy-N-methylethanamine;2-[(1Z)-1,4,4-triamino-3-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)buta-1,3-dienyl]phenol |
| SMILES | CC.CCOCCNC.CN1C2CCC1CN(C(/C=C(\N)c1ccccc1O)=C(N)N)C2 |
| InChI | InChI=1S/C17H25N5O.C5H13NO.C2H6/c1-21-11-6-7-12(21)10-22(9-11)15(17(19)20)8-14(18)13-4-2-3-5-16(13)23;1-3-7-5-4-6-2;1-2/h2-5,8,11-12,23H,6-7,9-10,18-20H2,1H3;6H,3-5H2,1-2H3;1-2H3/b14-8-;; |
| InChIKey | DNTKNLCITQIILC-KPHFHJPJSA-N |
| XLogP | 1.83 |
| TPSA | 126.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|