C34H51N9O3 — CID 155739546
2-[4-[4-(2-methylpyrimidin-5-yl)cyclohexyl]piperazin-1-yl]acetic acid;2-[(1Z)-1,4,4-triamino-3-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)buta-1,3-dienyl]phenol (PubChem CID 155739546) has the molecular formula C34H51N9O3 and a molecular weight of 633.84 g/mol. Its IUPAC name is 2-[4-[4-(2-methylpyrimidin-5-yl)cyclohexyl]piperazin-1-yl]acetic acid;2-[(1Z)-1,4,4-triamino-3-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)buta-1,3-dienyl]phenol.
| Compound Name | 2-[4-[4-(2-methylpyrimidin-5-yl)cyclohexyl]piperazin-1-yl]acetic acid;2-[(1Z)-1,4,4-triamino-3-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 155739546 |
| Molecular Formula | C34H51N9O3 |
| Molecular Weight | 633.84 g/mol |
| Exact Mass | 633.41 |
| IUPAC Name | 2-[4-[4-(2-methylpyrimidin-5-yl)cyclohexyl]piperazin-1-yl]acetic acid;2-[(1Z)-1,4,4-triamino-3-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)buta-1,3-dienyl]phenol |
| SMILES | CN1C2CCC1CN(C(/C=C(\N)c1ccccc1O)=C(N)N)C2.Cc1ncc(C2CCC(N3CCN(CC(=O)O)CC3)CC2)cn1 |
| InChI | InChI=1S/C17H25N5O.C17H26N4O2/c1-21-11-6-7-12(21)10-22(9-11)15(17(19)20)8-14(18)13-4-2-3-5-16(13)23;1-13-18-10-15(11-19-13)14-2-4-16(5-3-14)21-8-6-20(7-9-21)12-17(22)23/h2-5,8,11-12,23H,6-7,9-10,18-20H2,1H3;10-11,14,16H,2-9,12H2,1H3,(H,22,23)/b14-8-; |
| InChIKey | GHNYBRQSMDKWDV-ZXDBEMHSSA-N |
| XLogP | 2.07 |
| TPSA | 174.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.84 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|